C19H19F6N3O2 — CID 111597988
1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111597988) has the molecular formula C19H19F6N3O2 and a molecular weight of 435.37 g/mol. Its IUPAC name is 1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111597988 |
| Molecular Formula | C19H19F6N3O2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(OC(F)(F)F)cc1)NCc1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F6N3O2/c20-18(21,22)12-29-11-15-3-1-13(2-4-15)9-27-17(26)28-10-14-5-7-16(8-6-14)30-19(23,24)25/h1-8H,9-12H2,(H3,26,27,28) |
| InChIKey | WLWMFRAUGYETPT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|