C18H17F3N6O — CID 111598012
2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111598012) has the molecular formula C18H17F3N6O and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111598012 |
| Molecular Formula | C18H17F3N6O |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[(6-imidazol-1-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(-n2ccnc2)nc1)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N6O/c19-18(20,21)28-15-4-1-13(2-5-15)9-25-17(22)26-11-14-3-6-16(24-10-14)27-8-7-23-12-27/h1-8,10,12H,9,11H2,(H3,22,25,26) |
| InChIKey | ZUSLKXWWTTUWBI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|