C18H18F3IN6O — CID 111599813
2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111599813) has the molecular formula C18H18F3IN6O and a molecular weight of 518.28 g/mol. Its IUPAC name is 2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111599813 |
| Molecular Formula | C18H18F3IN6O |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccnc(-n2ccnc2)c1)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N6O.HI/c19-18(20,21)28-15-3-1-13(2-4-15)10-25-17(22)26-11-14-5-6-24-16(9-14)27-8-7-23-12-27;/h1-9,12H,10-11H2,(H3,22,25,26);1H |
| InChIKey | WXNUBQYVTOPIGF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|