C16H16F3IN4O3 — CID 111598989
2-[(3-nitrophenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111598989) has the molecular formula C16H16F3IN4O3 and a molecular weight of 496.23 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3-nitrophenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598989 |
| Molecular Formula | C16H16F3IN4O3 |
| Molecular Weight | 496.23 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 2-[(3-nitrophenyl)methyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc([N+](=O)[O-])c1)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N4O3.HI/c17-16(18,19)26-14-6-4-11(5-7-14)9-21-15(20)22-10-12-2-1-3-13(8-12)23(24)25;/h1-8H,9-10H2,(H3,20,21,22);1H |
| InChIKey | HSTYLJCFSTVSHA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|