C20H22N4O2S — CID 111051286
2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111051286) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111051286 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | COc1cccc(Oc2ccc(C/N=C(\N)NCCc3cccs3)cn2)c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-25-16-4-2-5-17(12-16)26-19-8-7-15(13-23-19)14-24-20(21)22-10-9-18-6-3-11-27-18/h2-8,11-13H,9-10,14H2,1H3,(H3,21,22,24) |
| InChIKey | VXFSPFCVRXCSCY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|