C19H25BrN4O2 — CID 167902962
1-(cyclobutylmethyl)-2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydrobromide (PubChem CID 167902962) has the molecular formula C19H25BrN4O2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydrobromide.
| Compound Name | 1-(cyclobutylmethyl)-2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydrobromide |
|---|---|
| PubChem CID | 167902962 |
| Molecular Formula | C19H25BrN4O2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydrobromide |
| SMILES | Br.COc1cccc(Oc2ccc(C/N=C(\N)NCC3CCC3)cn2)c1 |
| InChI | InChI=1S/C19H24N4O2.BrH/c1-24-16-6-3-7-17(10-16)25-18-9-8-15(12-21-18)13-23-19(20)22-11-14-4-2-5-14;/h3,6-10,12,14H,2,4-5,11,13H2,1H3,(H3,20,22,23);1H |
| InChIKey | ZSWZNIMVTMIUQV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|