C17H18FIN4 — CID 111821501
2-[(5-cyano-2-fluorophenyl)methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111821501) has the molecular formula C17H18FIN4 and a molecular weight of 424.26 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111821501 |
| Molecular Formula | C17H18FIN4 |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/Cc2cc(C#N)ccc2F)cc1C.I |
| InChI | InChI=1S/C17H17FN4.HI/c1-11-3-5-15(7-12(11)2)22-17(20)21-10-14-8-13(9-19)4-6-16(14)18;/h3-8H,10H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | FUXDUWLBUAMNKD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|