C16H12F4N4O — CID 111821545
2-[(5-cyano-2-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111821545) has the molecular formula C16H12F4N4O and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111821545 |
| Molecular Formula | C16H12F4N4O |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N#Cc1ccc(F)c(C/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H12F4N4O/c17-14-6-1-10(8-21)7-11(14)9-23-15(22)24-12-2-4-13(5-3-12)25-16(18,19)20/h1-7H,9H2,(H3,22,23,24) |
| InChIKey | GQTVXYBERLJZNA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|