C16H16Cl2N6 — CID 111031706
1-[1-(2,4-dichlorophenyl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111031706) has the molecular formula C16H16Cl2N6 and a molecular weight of 363.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111031706 |
| Molecular Formula | C16H16Cl2N6 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CC(N/C(N)=N/Cc1nnc2ccccn12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N6/c1-10(12-6-5-11(17)8-13(12)18)21-16(19)20-9-15-23-22-14-4-2-3-7-24(14)15/h2-8,10H,9H2,1H3,(H3,19,20,21) |
| InChIKey | DNRSMAUWLGFAFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|