C16H21Cl2N5 — CID 111070596
1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111070596) has the molecular formula C16H21Cl2N5 and a molecular weight of 354.29 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111070596 |
| Molecular Formula | C16H21Cl2N5 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CC(C/N=C(\N)NC(C)c1ccc(Cl)cc1Cl)Cn1cccn1 |
| InChI | InChI=1S/C16H21Cl2N5/c1-11(10-23-7-3-6-21-23)9-20-16(19)22-12(2)14-5-4-13(17)8-15(14)18/h3-8,11-12H,9-10H2,1-2H3,(H3,19,20,22) |
| InChIKey | RHDUTBFUJUARCR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|