C21H23Cl2N5 — CID 111911528
1-[1-(2,4-dichlorophenyl)ethyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine (PubChem CID 111911528) has the molecular formula C21H23Cl2N5 and a molecular weight of 416.36 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111911528 |
| Molecular Formula | C21H23Cl2N5 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine |
| SMILES | CC(N/C(N)=N/Cc1nccn1CCc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N5/c1-15(18-8-7-17(22)13-19(18)23)27-21(24)26-14-20-25-10-12-28(20)11-9-16-5-3-2-4-6-16/h2-8,10,12-13,15H,9,11,14H2,1H3,(H3,24,26,27) |
| InChIKey | RUIHROVHDDARHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|