C18H22Cl2IN3OS — CID 111807825
2-(2-benzylsulfinylethyl)-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111807825) has the molecular formula C18H22Cl2IN3OS and a molecular weight of 526.27 g/mol. Its IUPAC name is 2-(2-benzylsulfinylethyl)-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(2-benzylsulfinylethyl)-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807825 |
| Molecular Formula | C18H22Cl2IN3OS |
| Molecular Weight | 526.27 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 2-(2-benzylsulfinylethyl)-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCS(=O)Cc1ccccc1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H21Cl2N3OS.HI/c1-13(16-8-7-15(19)11-17(16)20)23-18(21)22-9-10-25(24)12-14-5-3-2-4-6-14;/h2-8,11,13H,9-10,12H2,1H3,(H3,21,22,23);1H |
| InChIKey | ZCCQNOBGDYIXLE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|