C14H20Cl2IN3OS — CID 120727976
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylsulfinylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 120727976) has the molecular formula C14H20Cl2IN3OS and a molecular weight of 476.21 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylsulfinylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylsulfinylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120727976 |
| Molecular Formula | C14H20Cl2IN3OS |
| Molecular Weight | 476.21 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylsulfinylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CC1(S(C)=O)CC1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C14H19Cl2N3OS.HI/c1-9(11-4-3-10(15)7-12(11)16)19-13(17)18-8-14(5-6-14)21(2)20;/h3-4,7,9H,5-6,8H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | OFOLYHNULJVTHW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|