C15H21Cl2N3O2 — CID 122082369
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-hydroxy-2-methyloxolan-3-yl)methyl]guanidine (PubChem CID 122082369) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-hydroxy-2-methyloxolan-3-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-hydroxy-2-methyloxolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 122082369 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-hydroxy-2-methyloxolan-3-yl)methyl]guanidine |
| SMILES | CC(N/C(N)=N/CC1(O)CCOC1C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O2/c1-9(12-4-3-11(16)7-13(12)17)20-14(18)19-8-15(21)5-6-22-10(15)2/h3-4,7,9-10,21H,5-6,8H2,1-2H3,(H3,18,19,20) |
| InChIKey | VPTZRAGSTTUFGN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|