C18H22Cl2N4O2S — CID 111062441
2-[2-(benzylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine (PubChem CID 111062441) has the molecular formula C18H22Cl2N4O2S and a molecular weight of 429.37 g/mol. Its IUPAC name is 2-[2-(benzylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine.
| Compound Name | 2-[2-(benzylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111062441 |
| Molecular Formula | C18H22Cl2N4O2S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-[2-(benzylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine |
| SMILES | CC(N/C(N)=N/CCS(=O)(=O)NCc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N4O2S/c1-13(16-8-7-15(19)11-17(16)20)24-18(21)22-9-10-27(25,26)23-12-14-5-3-2-4-6-14/h2-8,11,13,23H,9-10,12H2,1H3,(H3,21,22,24) |
| InChIKey | UUPDRYXFAVAFCM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|