C16H25Cl2IN4O2S — CID 111810063
2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111810063) has the molecular formula C16H25Cl2IN4O2S and a molecular weight of 535.28 g/mol. Its IUPAC name is 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111810063 |
| Molecular Formula | C16H25Cl2IN4O2S |
| Molecular Weight | 535.28 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | 2-[2-(cyclobutylmethylsulfamoyl)ethyl]-1-[1-(2,4-dichlorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCS(=O)(=O)NCC1CCC1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H24Cl2N4O2S.HI/c1-11(14-6-5-13(17)9-15(14)18)22-16(19)20-7-8-25(23,24)21-10-12-3-2-4-12;/h5-6,9,11-12,21H,2-4,7-8,10H2,1H3,(H3,19,20,22);1H |
| InChIKey | VJWVZQAHKMMTKS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|