C18H28Cl2N4 — CID 111086387
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine (PubChem CID 111086387) has the molecular formula C18H28Cl2N4 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111086387 |
| Molecular Formula | C18H28Cl2N4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-propan-2-ylpiperidin-3-yl)methyl]guanidine |
| SMILES | CC(N/C(N)=N/CC1CCCN(C(C)C)C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H28Cl2N4/c1-12(2)24-8-4-5-14(11-24)10-22-18(21)23-13(3)16-7-6-15(19)9-17(16)20/h6-7,9,12-14H,4-5,8,10-11H2,1-3H3,(H3,21,22,23) |
| InChIKey | OOAHTYUYADRTKN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|