C16H22Cl2N4O — CID 111066175
4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-cyclopropylbutanamide (PubChem CID 111066175) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.29 g/mol. Its IUPAC name is 4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 111066175 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-cyclopropylbutanamide |
| SMILES | CC(N/C(N)=N/CCCC(=O)NC1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2N4O/c1-10(13-7-4-11(17)9-14(13)18)21-16(19)20-8-2-3-15(23)22-12-5-6-12/h4,7,9-10,12H,2-3,5-6,8H2,1H3,(H,22,23)(H3,19,20,21) |
| InChIKey | GAFJBRYPPLZSEH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|