About 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine
3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine (PubChem CID 20504188) has the molecular formula C16H15Cl2NO2
and a molecular weight of 324.21 g/mol. Its IUPAC name is 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine.
Molecular Properties
| Compound Name | 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine |
| PubChem CID | 20504188 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine |
| SMILES | CC(c1ccc(Cl)cc1Cl)C1(c2cccnc2)OCCO1 |
| InChI | InChI=1S/C16H15Cl2NO2/c1-11(14-5-4-13(17)9-15(14)18)16(20-7-8-21-16)12-3-2-6-19-10-12/h2-6,9-11H,7-8H2,1H3 |
| InChIKey | QBDMHXNIOKJYBA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine?
The IUPAC name of 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine (CID 20504188) is 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine.
What is the SMILES notation for 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine?
The canonical SMILES for 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine is CC(c1ccc(Cl)cc1Cl)C1(c2cccnc2)OCCO1.
What is the InChIKey of 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine?
The InChIKey is QBDMHXNIOKJYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO2/c1-11(14-5-4-13(17)9-15(14)18)16(20-7-8-21-16)12-3-2-6-19-10-12/h2-6,9-11H,7-8H2,1H3.
What are the key properties of 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine?
3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine has a molecular weight of 324.21 g/mol, XLogP of 4.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[1-(2,4-dichlorophenyl)ethyl]-1,3-dioxolan-2-yl]pyridine is sourced from PubChem (CID 20504188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).