C13H11Cl3N2 — CID 79840895
3-chloro-N-[1-(2,4-dichlorophenyl)ethyl]pyridin-4-amine (PubChem CID 79840895) has the molecular formula C13H11Cl3N2 and a molecular weight of 301.60 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,4-dichlorophenyl)ethyl]pyridin-4-amine.
| Compound Name | 3-chloro-N-[1-(2,4-dichlorophenyl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 79840895 |
| Molecular Formula | C13H11Cl3N2 |
| Molecular Weight | 301.60 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3-chloro-N-[1-(2,4-dichlorophenyl)ethyl]pyridin-4-amine |
| SMILES | CC(Nc1ccncc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2/c1-8(10-3-2-9(14)6-11(10)15)18-13-4-5-17-7-12(13)16/h2-8H,1H3,(H,17,18) |
| InChIKey | BCRGWZHKKQFMRF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |