C14H11Cl4N — CID 43099454
3,5-dichloro-N-[1-(2,4-dichlorophenyl)ethyl]aniline (PubChem CID 43099454) has the molecular formula C14H11Cl4N and a molecular weight of 335.06 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-(2,4-dichlorophenyl)ethyl]aniline.
| Compound Name | 3,5-dichloro-N-[1-(2,4-dichlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43099454 |
| Molecular Formula | C14H11Cl4N |
| Molecular Weight | 335.06 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 3,5-dichloro-N-[1-(2,4-dichlorophenyl)ethyl]aniline |
| SMILES | CC(Nc1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl4N/c1-8(13-3-2-9(15)7-14(13)18)19-12-5-10(16)4-11(17)6-12/h2-8,19H,1H3 |
| InChIKey | OQYQWFHPIVTCFI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.06 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |