C12H11Cl2NS — CID 66351684
N-[1-(2,4-dichlorophenyl)ethyl]thiophen-3-amine (PubChem CID 66351684) has the molecular formula C12H11Cl2NS and a molecular weight of 272.20 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]thiophen-3-amine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66351684 |
| Molecular Formula | C12H11Cl2NS |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]thiophen-3-amine |
| SMILES | CC(Nc1ccsc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2NS/c1-8(15-10-4-5-16-7-10)11-3-2-9(13)6-12(11)14/h2-8,15H,1H3 |
| InChIKey | OPJHMVZDJYJLLL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |