C18H22Cl2 — CID 162264964
cumene;2,4-dichloro-1-propan-2-ylbenzene (PubChem CID 162264964) has the molecular formula C18H22Cl2 and a molecular weight of 309.28 g/mol. Its IUPAC name is cumene;2,4-dichloro-1-propan-2-ylbenzene.
| Compound Name | cumene;2,4-dichloro-1-propan-2-ylbenzene |
|---|---|
| PubChem CID | 162264964 |
| Molecular Formula | C18H22Cl2 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | cumene;2,4-dichloro-1-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(Cl)cc1Cl.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H10Cl2.C9H12/c1-6(2)8-4-3-7(10)5-9(8)11;1-8(2)9-6-4-3-5-7-9/h3-6H,1-2H3;3-8H,1-2H3 |
| InChIKey | ZZTWECNMONOTCV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |