C13H12Cl3NO — CID 155564613
O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine;hydrochloride (PubChem CID 155564613) has the molecular formula C13H12Cl3NO and a molecular weight of 304.60 g/mol. Its IUPAC name is O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine;hydrochloride.
| Compound Name | O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 155564613 |
| Molecular Formula | C13H12Cl3NO |
| Molecular Weight | 304.60 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | O-[(2,4-dichlorophenyl)-phenylmethyl]hydroxylamine;hydrochloride |
| SMILES | Cl.NOC(c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2NO.ClH/c14-10-6-7-11(12(15)8-10)13(17-16)9-4-2-1-3-5-9;/h1-8,13H,16H2;1H |
| InChIKey | NJJSJNMGOHDNGX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|