C14H8Cl6O2 — CID 174946980
2,4-dichloro-1-[chloro-[chloro-(2,4-dichlorophenyl)methyl]peroxymethyl]benzene (PubChem CID 174946980) has the molecular formula C14H8Cl6O2 and a molecular weight of 420.93 g/mol. Its IUPAC name is 2,4-dichloro-1-[chloro-[chloro-(2,4-dichlorophenyl)methyl]peroxymethyl]benzene.
| Compound Name | 2,4-dichloro-1-[chloro-[chloro-(2,4-dichlorophenyl)methyl]peroxymethyl]benzene |
|---|---|
| PubChem CID | 174946980 |
| Molecular Formula | C14H8Cl6O2 |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 417.87 |
| IUPAC Name | 2,4-dichloro-1-[chloro-[chloro-(2,4-dichlorophenyl)methyl]peroxymethyl]benzene |
| SMILES | Clc1ccc(C(Cl)OOC(Cl)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl6O2/c15-7-1-3-9(11(17)5-7)13(19)21-22-14(20)10-4-2-8(16)6-12(10)18/h1-6,13-14H |
| InChIKey | SXZGNPFSVOWJAP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|