C13H7BrCl4 — CID 63444065
1-[(5-bromo-2-chlorophenyl)-chloromethyl]-2,4-dichlorobenzene (PubChem CID 63444065) has the molecular formula C13H7BrCl4 and a molecular weight of 384.92 g/mol. Its IUPAC name is 1-[(5-bromo-2-chlorophenyl)-chloromethyl]-2,4-dichlorobenzene.
| Compound Name | 1-[(5-bromo-2-chlorophenyl)-chloromethyl]-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 63444065 |
| Molecular Formula | C13H7BrCl4 |
| Molecular Weight | 384.92 g/mol |
| Exact Mass | 381.85 |
| IUPAC Name | 1-[(5-bromo-2-chlorophenyl)-chloromethyl]-2,4-dichlorobenzene |
| SMILES | Clc1ccc(C(Cl)c2cc(Br)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H7BrCl4/c14-7-1-4-11(16)10(5-7)13(18)9-3-2-8(15)6-12(9)17/h1-6,13H |
| InChIKey | QRCURZVPJQCPKT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.92 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|