C14H12BrCl2N — CID 65307651
(5-bromo-2-methylphenyl)-(2,4-dichlorophenyl)methanamine (PubChem CID 65307651) has the molecular formula C14H12BrCl2N and a molecular weight of 345.07 g/mol. Its IUPAC name is (5-bromo-2-methylphenyl)-(2,4-dichlorophenyl)methanamine.
| Compound Name | (5-bromo-2-methylphenyl)-(2,4-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 65307651 |
| Molecular Formula | C14H12BrCl2N |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | (5-bromo-2-methylphenyl)-(2,4-dichlorophenyl)methanamine |
| SMILES | Cc1ccc(Br)cc1C(N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12BrCl2N/c1-8-2-3-9(15)6-12(8)14(18)11-5-4-10(16)7-13(11)17/h2-7,14H,18H2,1H3 |
| InChIKey | DIRSMSPSNBHPRC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |