C14H11Br2F2N — CID 65307701
(4-bromo-2,5-difluorophenyl)-(5-bromo-2-methylphenyl)methanamine (PubChem CID 65307701) has the molecular formula C14H11Br2F2N and a molecular weight of 391.05 g/mol. Its IUPAC name is (4-bromo-2,5-difluorophenyl)-(5-bromo-2-methylphenyl)methanamine.
| Compound Name | (4-bromo-2,5-difluorophenyl)-(5-bromo-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 65307701 |
| Molecular Formula | C14H11Br2F2N |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | (4-bromo-2,5-difluorophenyl)-(5-bromo-2-methylphenyl)methanamine |
| SMILES | Cc1ccc(Br)cc1C(N)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H11Br2F2N/c1-7-2-3-8(15)4-9(7)14(19)10-5-13(18)11(16)6-12(10)17/h2-6,14H,19H2,1H3 |
| InChIKey | GOGDGBBQDILBRP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|