C9H4Cl3F5 — CID 55198798
2,4-dichloro-1-(1-chloro-2,2,3,3,3-pentafluoropropyl)benzene (PubChem CID 55198798) has the molecular formula C9H4Cl3F5 and a molecular weight of 313.48 g/mol. Its IUPAC name is 2,4-dichloro-1-(1-chloro-2,2,3,3,3-pentafluoropropyl)benzene.
| Compound Name | 2,4-dichloro-1-(1-chloro-2,2,3,3,3-pentafluoropropyl)benzene |
|---|---|
| PubChem CID | 55198798 |
| Molecular Formula | C9H4Cl3F5 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 2,4-dichloro-1-(1-chloro-2,2,3,3,3-pentafluoropropyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H4Cl3F5/c10-4-1-2-5(6(11)3-4)7(12)8(13,14)9(15,16)17/h1-3,7H |
| InChIKey | SYEYGNKHSOBRSD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|