About 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol
1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol (PubChem CID 70595860) has the molecular formula C21H17Cl3O
and a molecular weight of 391.73 g/mol. Its IUPAC name is 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol |
| PubChem CID | 70595860 |
| Molecular Formula | C21H17Cl3O |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol |
| SMILES | CC(O)(c1ccc(-c2ccccc2)cc1)C(Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl3O/c1-21(25,20(24)18-12-11-17(22)13-19(18)23)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-13,20,25H,1H3 |
| InChIKey | WMWSEWHGGQJHDS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol?
The IUPAC name of 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol (CID 70595860) is 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol.
What is the SMILES notation for 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol?
The canonical SMILES for 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol is CC(O)(c1ccc(-c2ccccc2)cc1)C(Cl)c1ccc(Cl)cc1Cl.
What is the InChIKey of 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol?
The InChIKey is WMWSEWHGGQJHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl3O/c1-21(25,20(24)18-12-11-17(22)13-19(18)23)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-13,20,25H,1H3.
What are the key properties of 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol?
1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol has a molecular weight of 391.73 g/mol, XLogP of 6.85, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol is sourced from PubChem (CID 70595860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).