C21H17Cl3O — CID 70595860
1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol (PubChem CID 70595860) has the molecular formula C21H17Cl3O and a molecular weight of 391.73 g/mol. Its IUPAC name is 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol.
| Compound Name | 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 70595860 |
| Molecular Formula | C21H17Cl3O |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 1-chloro-1-(2,4-dichlorophenyl)-2-(4-phenylphenyl)propan-2-ol |
| SMILES | CC(O)(c1ccc(-c2ccccc2)cc1)C(Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl3O/c1-21(25,20(24)18-12-11-17(22)13-19(18)23)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-13,20,25H,1H3 |
| InChIKey | WMWSEWHGGQJHDS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|