C17H19Cl2NO — CID 62373504
1-[1-(2,4-dichlorophenyl)ethylamino]-2-phenylpropan-2-ol (PubChem CID 62373504) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethylamino]-2-phenylpropan-2-ol.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethylamino]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 62373504 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethylamino]-2-phenylpropan-2-ol |
| SMILES | CC(NCC(C)(O)c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2NO/c1-12(15-9-8-14(18)10-16(15)19)20-11-17(2,21)13-6-4-3-5-7-13/h3-10,12,20-21H,11H2,1-2H3 |
| InChIKey | MSIKSCONBFGSIQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |