C18H23NO2 — CID 81389941
1-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-phenylpropan-2-ol (PubChem CID 81389941) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-phenylpropan-2-ol.
| Compound Name | 1-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 81389941 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-phenylpropan-2-ol |
| SMILES | COc1ccccc1[C@H](C)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO2/c1-14(16-11-7-8-12-17(16)21-3)19-13-18(2,20)15-9-5-4-6-10-15/h4-12,14,19-20H,13H2,1-3H3/t14-,18?/m0/s1 |
| InChIKey | OJNZHXLNQDJREQ-PIVQAISJSA-N |
| XLogP | 3.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |