C14H21NO4 — CID 104644838
methyl 2-hydroxy-3-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-methylpropanoate (PubChem CID 104644838) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-hydroxy-3-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 104644838 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 2-hydroxy-3-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CN[C@@H](C)c1ccccc1OC |
| InChI | InChI=1S/C14H21NO4/c1-10(11-7-5-6-8-12(11)18-3)15-9-14(2,17)13(16)19-4/h5-8,10,15,17H,9H2,1-4H3/t10-,14?/m0/s1 |
| InChIKey | NDMBKNSWACZXAH-XLLULAGJSA-N |
| XLogP | 1.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |