C22H21Cl — CID 176866089
1-(4-tert-butylphenyl)-2-chloro-4-phenylbenzene (PubChem CID 176866089) has the molecular formula C22H21Cl and a molecular weight of 320.86 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-chloro-4-phenylbenzene.
| Compound Name | 1-(4-tert-butylphenyl)-2-chloro-4-phenylbenzene |
|---|---|
| PubChem CID | 176866089 |
| Molecular Formula | C22H21Cl |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-chloro-4-phenylbenzene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C22H21Cl/c1-22(2,3)19-12-9-17(10-13-19)20-14-11-18(15-21(20)23)16-7-5-4-6-8-16/h4-15H,1-3H3 |
| InChIKey | CSBREDDXJLPXCF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |