C9H6Cl2F5N — CID 43248571
1-(2,5-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 43248571) has the molecular formula C9H6Cl2F5N and a molecular weight of 294.05 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 43248571 |
| Molecular Formula | C9H6Cl2F5N |
| Molecular Weight | 294.05 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | NC(c1cc(Cl)ccc1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6Cl2F5N/c10-4-1-2-6(11)5(3-4)7(17)8(12,13)9(14,15)16/h1-3,7H,17H2 |
| InChIKey | XLSJDAPLFCUWIT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.05 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|