C10H7ClF5NO2 — CID 171312703
(1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 171312703) has the molecular formula C10H7ClF5NO2 and a molecular weight of 303.61 g/mol. Its IUPAC name is (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 171312703 |
| Molecular Formula | C10H7ClF5NO2 |
| Molecular Weight | 303.61 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (1R)-1-(6-chloro-1,3-benzodioxol-5-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | N[C@H](c1cc2c(cc1Cl)OCO2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7ClF5NO2/c11-5-2-7-6(18-3-19-7)1-4(5)8(17)9(12,13)10(14,15)16/h1-2,8H,3,17H2/t8-/m1/s1 |
| InChIKey | WWFDPTMDZCWZCE-MRVPVSSYSA-N |
| XLogP | 3.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|