C10H10Cl2F5NO — CID 171312698
2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloro-6-methylphenol;hydrochloride (PubChem CID 171312698) has the molecular formula C10H10Cl2F5NO and a molecular weight of 326.09 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171312698 |
| Molecular Formula | C10H10Cl2F5NO |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-chloro-6-methylphenol;hydrochloride |
| SMILES | Cc1cc(Cl)cc([C@@H](N)C(F)(F)C(F)(F)F)c1O.Cl |
| InChI | InChI=1S/C10H9ClF5NO.ClH/c1-4-2-5(11)3-6(7(4)18)8(17)9(12,13)10(14,15)16;/h2-3,8,18H,17H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | LSHLEHZDBZXWRV-DDWIOCJRSA-N |
| XLogP | 3.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|