C10H12Cl2F3NO — CID 171234623
2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-chloro-6-methylphenol;hydrochloride (PubChem CID 171234623) has the molecular formula C10H12Cl2F3NO and a molecular weight of 290.11 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-chloro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-chloro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171234623 |
| Molecular Formula | C10H12Cl2F3NO |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-chloro-6-methylphenol;hydrochloride |
| SMILES | Cc1cc(Cl)cc([C@@H](N)CC(F)(F)F)c1O.Cl |
| InChI | InChI=1S/C10H11ClF3NO.ClH/c1-5-2-6(11)3-7(9(5)16)8(15)4-10(12,13)14;/h2-3,8,16H,4,15H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | UIHXQDWIGZRYCN-QRPNPIFTSA-N |
| XLogP | 3.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|