C12H19Cl2NO — CID 171214989
2-[(1R)-1-amino-3-methylbutyl]-4-chloro-6-methylphenol;hydrochloride (PubChem CID 171214989) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-methylbutyl]-4-chloro-6-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-methylbutyl]-4-chloro-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171214989 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[(1R)-1-amino-3-methylbutyl]-4-chloro-6-methylphenol;hydrochloride |
| SMILES | Cc1cc(Cl)cc([C@H](N)CC(C)C)c1O.Cl |
| InChI | InChI=1S/C12H18ClNO.ClH/c1-7(2)4-11(14)10-6-9(13)5-8(3)12(10)15;/h5-7,11,15H,4,14H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | SFBDZCJHZRRHJE-RFVHGSKJSA-N |
| XLogP | 3.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|