C12H20ClNO — CID 171212407
2-[(1R)-1-amino-3-methylbutyl]-5-methylphenol;hydrochloride (PubChem CID 171212407) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-methylbutyl]-5-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-methylbutyl]-5-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171212407 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-[(1R)-1-amino-3-methylbutyl]-5-methylphenol;hydrochloride |
| SMILES | Cc1ccc([C@H](N)CC(C)C)c(O)c1.Cl |
| InChI | InChI=1S/C12H19NO.ClH/c1-8(2)6-11(13)10-5-4-9(3)7-12(10)14;/h4-5,7-8,11,14H,6,13H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | ONOGQVZMQDWSMV-RFVHGSKJSA-N |
| XLogP | 3.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|