C11H19ClN2O — CID 171212396
2-[(1R)-1,4-diaminobutyl]-5-methylphenol;hydrochloride (PubChem CID 171212396) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is 2-[(1R)-1,4-diaminobutyl]-5-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1,4-diaminobutyl]-5-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171212396 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-[(1R)-1,4-diaminobutyl]-5-methylphenol;hydrochloride |
| SMILES | Cc1ccc([C@H](N)CCCN)c(O)c1.Cl |
| InChI | InChI=1S/C11H18N2O.ClH/c1-8-4-5-9(11(14)7-8)10(13)3-2-6-12;/h4-5,7,10,14H,2-3,6,12-13H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | PNTUUHCFTZMGIE-HNCPQSOCSA-N |
| XLogP | 1.86 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|