C11H16ClNO2 — CID 171234646
2-[(1S)-1-amino-4-hydroxybutyl]-4-chloro-6-methylphenol (PubChem CID 171234646) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-[(1S)-1-amino-4-hydroxybutyl]-4-chloro-6-methylphenol.
| Compound Name | 2-[(1S)-1-amino-4-hydroxybutyl]-4-chloro-6-methylphenol |
|---|---|
| PubChem CID | 171234646 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(1S)-1-amino-4-hydroxybutyl]-4-chloro-6-methylphenol |
| SMILES | Cc1cc(Cl)cc([C@@H](N)CCCO)c1O |
| InChI | InChI=1S/C11H16ClNO2/c1-7-5-8(12)6-9(11(7)15)10(13)3-2-4-14/h5-6,10,14-15H,2-4,13H2,1H3/t10-/m0/s1 |
| InChIKey | OCYYMIKMGYFVIK-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|