C11H15Cl2NO — CID 171197706
2-[(1R)-1-aminopentyl]-4,6-dichlorophenol (PubChem CID 171197706) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 2-[(1R)-1-aminopentyl]-4,6-dichlorophenol.
| Compound Name | 2-[(1R)-1-aminopentyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 171197706 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[(1R)-1-aminopentyl]-4,6-dichlorophenol |
| SMILES | CCCC[C@@H](N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C11H15Cl2NO/c1-2-3-4-10(14)8-5-7(12)6-9(13)11(8)15/h5-6,10,15H,2-4,14H2,1H3/t10-/m1/s1 |
| InChIKey | PDOFJFQDZNTIOR-SNVBAGLBSA-N |
| XLogP | 3.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|