C15H22Cl2N2O — CID 171308533
2,4-dichloro-6-[(1S)-1-piperazin-1-ylpentyl]phenol (PubChem CID 171308533) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 2,4-dichloro-6-[(1S)-1-piperazin-1-ylpentyl]phenol.
| Compound Name | 2,4-dichloro-6-[(1S)-1-piperazin-1-ylpentyl]phenol |
|---|---|
| PubChem CID | 171308533 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2,4-dichloro-6-[(1S)-1-piperazin-1-ylpentyl]phenol |
| SMILES | CCCC[C@@H](c1cc(Cl)cc(Cl)c1O)N1CCNCC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-2-3-4-14(19-7-5-18-6-8-19)12-9-11(16)10-13(17)15(12)20/h9-10,14,18,20H,2-8H2,1H3/t14-/m0/s1 |
| InChIKey | VMOCXYZZQJLHQU-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|