C15H22Cl2F2N2 — CID 171166930
1-[(1S)-1-(4-chloro-2,6-difluorophenyl)pentyl]piperazine;hydrochloride (PubChem CID 171166930) has the molecular formula C15H22Cl2F2N2 and a molecular weight of 339.26 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chloro-2,6-difluorophenyl)pentyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(4-chloro-2,6-difluorophenyl)pentyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166930 |
| Molecular Formula | C15H22Cl2F2N2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[(1S)-1-(4-chloro-2,6-difluorophenyl)pentyl]piperazine;hydrochloride |
| SMILES | CCCC[C@@H](c1c(F)cc(Cl)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H21ClF2N2.ClH/c1-2-3-4-14(20-7-5-19-6-8-20)15-12(17)9-11(16)10-13(15)18;/h9-10,14,19H,2-8H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | AFBTZKOOWRVZTN-UQKRIMTDSA-N |
| XLogP | 4.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |