C8H8Cl2FNO — CID 130059324
2-(1-amino-2-fluoroethyl)-4,6-dichlorophenol (PubChem CID 130059324) has the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. Its IUPAC name is 2-(1-amino-2-fluoroethyl)-4,6-dichlorophenol.
| Compound Name | 2-(1-amino-2-fluoroethyl)-4,6-dichlorophenol |
|---|---|
| PubChem CID | 130059324 |
| Molecular Formula | C8H8Cl2FNO |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-(1-amino-2-fluoroethyl)-4,6-dichlorophenol |
| SMILES | NC(CF)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H8Cl2FNO/c9-4-1-5(7(12)3-11)8(13)6(10)2-4/h1-2,7,13H,3,12H2 |
| InChIKey | YXEBRLSTPXKVSA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|