C9H10Cl3F2NO2 — CID 171238704
2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4,6-dichlorophenol;hydrochloride (PubChem CID 171238704) has the molecular formula C9H10Cl3F2NO2 and a molecular weight of 308.54 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4,6-dichlorophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4,6-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171238704 |
| Molecular Formula | C9H10Cl3F2NO2 |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4,6-dichlorophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(Cl)cc(Cl)c1O)C(F)(F)CO |
| InChI | InChI=1S/C9H9Cl2F2NO2.ClH/c10-4-1-5(7(16)6(11)2-4)8(14)9(12,13)3-15;/h1-2,8,15-16H,3,14H2;1H/t8-;/m1./s1 |
| InChIKey | PTACWIQAAQANLN-DDWIOCJRSA-N |
| XLogP | 2.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|