C9H9BrF3NO2 — CID 131342980
2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-bromo-6-fluorophenol (PubChem CID 131342980) has the molecular formula C9H9BrF3NO2 and a molecular weight of 300.07 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-bromo-6-fluorophenol.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-bromo-6-fluorophenol |
|---|---|
| PubChem CID | 131342980 |
| Molecular Formula | C9H9BrF3NO2 |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-bromo-6-fluorophenol |
| SMILES | N[C@H](c1cc(Br)cc(F)c1O)C(F)(F)CO |
| InChI | InChI=1S/C9H9BrF3NO2/c10-4-1-5(7(16)6(11)2-4)8(14)9(12,13)3-15/h1-2,8,15-16H,3,14H2/t8-/m1/s1 |
| InChIKey | HZQNESYUXUJSSN-MRVPVSSYSA-N |
| XLogP | 1.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|