C9H10Br2F2N2O — CID 171246073
(3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropan-1-ol (PubChem CID 171246073) has the molecular formula C9H10Br2F2N2O and a molecular weight of 360.00 g/mol. Its IUPAC name is (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropan-1-ol.
| Compound Name | (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 171246073 |
| Molecular Formula | C9H10Br2F2N2O |
| Molecular Weight | 360.00 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)-2,2-difluoropropan-1-ol |
| SMILES | Nc1c(Br)cc(Br)cc1[C@H](N)C(F)(F)CO |
| InChI | InChI=1S/C9H10Br2F2N2O/c10-4-1-5(7(14)6(11)2-4)8(15)9(12,13)3-16/h1-2,8,16H,3,14-15H2/t8-/m0/s1 |
| InChIKey | OZKGCMBYTQYEFJ-QMMMGPOBSA-N |
| XLogP | 2.42 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.00 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|