C8H8Br2F2N2 — CID 131035663
2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-dibromoaniline (PubChem CID 131035663) has the molecular formula C8H8Br2F2N2 and a molecular weight of 329.97 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-dibromoaniline.
| Compound Name | 2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-dibromoaniline |
|---|---|
| PubChem CID | 131035663 |
| Molecular Formula | C8H8Br2F2N2 |
| Molecular Weight | 329.97 g/mol |
| Exact Mass | 327.90 |
| IUPAC Name | 2-[(1S)-1-amino-2,2-difluoroethyl]-4,6-dibromoaniline |
| SMILES | Nc1c(Br)cc(Br)cc1[C@H](N)C(F)F |
| InChI | InChI=1S/C8H8Br2F2N2/c9-3-1-4(7(14)8(11)12)6(13)5(10)2-3/h1-2,7-8H,13-14H2/t7-/m0/s1 |
| InChIKey | ZZKQASVLRXLCJZ-ZETCQYMHSA-N |
| XLogP | 3.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.97 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|